Product Overview
Protosappanin B | T6S1780 | TargetMol Chemicals
CAS: 102036-29-3
Smiles: OC[C@]1(O)COc2cc(O)ccc2-c2cc(O)c(O)cc2C1
Formula: C16H16O6
Pathway: Apoptosis
Target: Apoptosis
Receptor: N/A
Bioactivity: 1. Protosappanin B significantly increases cell viability, inhibits cell apoptosis and up-regulates the expression of growth-associated protein 43. 2. Protosappanin B induces the degradation of p53 protein, via activation of a MDM2-dependent ubiquitination process.
Molecular Weight: 304, 298
