Product Overview
Pyridostatin | T1899 | TargetMol Chemicals
CAS: 1085412-37-8
Smiles: NCCOc1cc(nc(c1)C(=O)Nc1cc(OCCN)c2ccccc2n1)C(=O)Nc1cc(OCCN)c2ccccc2n1
Formula: C31H32N8O5
Pathway: Cell Cycle/Checkpoint|||DNA Damage/DNA Repair
Target: DNA/RNA Synthesis
Receptor: N/A
Bioactivity: Pyridostatin is a synthetic small-molecule stabilizer of G-quadruplexes, a secondary structure of DNA that usually exists in the end of the chromosome or the telomeres.
Molecular Weight: 596, 648
