Product Overview
Rabdosin B | TN4890 | TargetMol Chemicals
CAS: 84304-92-7
Smiles: CC(=O)OC[C@@H]1C(C)(C)CC[C@H](OC(C)=O)[C@]11COC(=O)[C@@]23C[C@@H](C[C@H](O)[C@@H]12)C(=C)C3=O
Formula: C24H32O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Rabdosin B shows cytotoxic activity against three human tumour HepG2, GLC-82 and HL-60 cell lines, it induces significant DNA damage to HepG2 cells in a time- and dose-dependent manner. Rabdosin B at higher concentrations inhibits root growth by affecting both cell length in the mature region and division of meristematic cells.
Molecular Weight: 448, 5
