Product Overview
RH01386 | T13867 | TargetMol Chemicals
CAS: 301177-36-6
Smiles: [O-][N+](=O)c1cc(ccc1Sc1nc(C2CCCCC2)c(C#N)c(=O)[nH]1)C(F)(F)F
Formula: C18H15F3N4O3S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: RH01386 is a small molecule that can prevent ER stress-induced β cell dysfunction and death, and inhibits proapoptotic gene expression, has the potential for type 2 diabetes treatment. RH01386 restores ER stress-impaired glucose-stimulated insulin secretion responses.
Molecular Weight: 424, 4