Product Overview
Rhosin hydrochloride | T16745 | TargetMol Chemicals
CAS: 1281870-42-5
Smiles: Cl.N[C@H](Cc1c[nH]c2ccccc12)C(=O)N\N=C\c1ccc2nccnc2c1
Formula: C20H19ClN6O
Pathway: Apoptosis|||Cell Cycle/Checkpoint|||GPCR/G Protein|||MAPK
Target: Apoptosis|||Rho|||Ras
Receptor: N/A
Bioactivity: Rhosin hydrochloride is an effective and specific RhoA subfamily Rho GTPases inhibitor, which specifically binds to RhoA to inhibit RhoA-GEF interaction (Kd: ~ 0.4 uM). Rhosin hydrochloride does not interact with Cdc42 or Rac1, nor the GEF, LARG. Rhosin hydrochloride causes cell apoptosis.
Molecular Weight: 394, 86
