Product Overview
Rubrofusarin gentiobioside | TN2165 | TargetMol Chemicals
CAS: 24577-90-0
Smiles: OC1=C2C(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO)=CC(OC)=CC2=CC5=C1C(C=C(C)O5)=O
Formula: C27H32O15
Pathway: MAPK|||NF-Κb|||Stem Cells
Target: ERK|||NF-κB|||TGF-beta/Smad
Receptor: N/A
Bioactivity: Rubrofusarin-6-O-beta-D-gentiobioside can significantly decrease the expression of TGF-beta1 and fibronectin and NF-kappaB DNA binding activity, suggests that it has potential as a preventive agent for advanced glycation end products-related diabetic complications.
Molecular Weight: 596, 5
