Product Overview
S-(4-Hydroxybenzyl)glutathione | TN7044 | TargetMol Chemicals
CAS: 129636-38-0
Smiles: N[C@@H](CCC(N[C@@H](CSCc(cc1)ccc1O)C(NCC(O)=O)=O)=O)C(O)=O
Formula: C17H23N3O7S
Pathway: Neuroscience
Target: GluR
Receptor: N/A
Bioactivity: L-γ-Glutamyl-S-[(4-hydroxyphenyl)methyl] was isolated as the major principle responsible for the inhibition of the in vitro binding of kainic acid to brain glutamate receptors by water extracts of the plant Gastrodia elata.
Molecular Weight: 413, 45
