Product Overview
(S, R, S)-AHPC-C3-NH2 | T18664 | TargetMol Chemicals
CAS: 2361119-88-0
Smiles: Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCN)C(C)(C)C)cc1
Formula: C26H37N5O4S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: (S, R, S)-AHPC-C3-NH2 (VH032-C3-NH2) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used in PROTAC technology. (S, R, S)-AHPC-C3-NH2 can be used in the synthesis of a series of PROTACs, such as UNC6852. UNC6852 is an EED-targeted bivalent chemical degrader[1].
Molecular Weight: 515, 67
