Product Overview
Saclofen | T4440 | TargetMol Chemicals
CAS: 125464-42-8
Smiles: NCC(CS(O)(=O)=O)c1ccc(Cl)cc1
Formula: C9H12ClNO3S
Pathway: Membrane transporter/Ion channel|||Neuroscience
Target: GABA Receptor
Receptor: N/A
Bioactivity: Saclofen is a sulfonic analog of the inhibitory neurotransmitter Ī³-aminobutyric acid (GABA) that acts as a competitive antagonist of the GABAB receptor (IC50: 7.8 Ī¼M).1 This compound can be used to determine the functional roles for the GABAB receptor as a mediator of slow inhibitory postsynaptic potentials in the brain.
Molecular Weight: 249, 71
