Product Overview
Scopolamine | T3S0478 | TargetMol Chemicals
CAS: 51-34-3
Smiles: CN1[C@H]2C[C@@H](C[C@@H]1[C@H]1O[C@@H]21)OC(=O)[C@H](CO)c1ccccc1
Formula: C17H21NO4
Pathway: GPCR/G Protein|||Metabolism|||Neuroscience
Target: 5-HT Receptor|||Endogenous Metabolite|||AChR
Receptor: N/A
Bioactivity: 1. Scopolamine, a nonselective muscarinic receptor antagonist, induces distinct behaviors of attenuated motility and C-like hyperactivity. 2. Scopolamine can increase acetylcholinesterase activity by was significantly attenuated by RCM treatment. 3. Scopolamine can cause learning and memory impairments and galantamine can reverse the symptom. 4. Scopolamine produces rapid and significant symptom improvement in patients with depression.
Molecular Weight: 303, 358
