Product Overview
Scutellarin methyl ester | T2S0842 | TargetMol Chemicals
CAS: 119262-68-9
Smiles: COC(=O)[C@H]1O[C@@H](Oc2cc3oc(cc(=O)c3c(O)c2O)-c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O
Formula: C22H20O12
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Scutellarin methylester has the effect of improving sleep, such as prolonging sleep time, increasing the incidence of sleep, shortening sleep latency, which also helps to delay aging process.
Molecular Weight: 476, 39
 
             
             
                    
            
            
            
           