Product Overview
Semilicoisoflavone B | TN2201 | TargetMol Chemicals
CAS: 129280-33-7
Smiles: CC1(C)Oc2c(O)cc(cc2C=C1)-c1coc2cc(O)cc(O)c2c1=O
Formula: C20H16O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Semilicoisoflavone B can inhibit sorbitol formation of rat lens incubated with a high concentration of glucose, indicates that it may be effective for preventing osmotic stress in hyperglycemia.
Molecular Weight: 352, 342
