Product Overview
Sertindole | T5858 | TargetMol Chemicals
CAS: 106516-24-9
Smiles: Fc1ccc(cc1)-n1cc(C2CCN(CCN3CCNC3=O)CC2)c2cc(Cl)ccc12
Formula: C24H26ClFN4O
Pathway: Autophagy|||GPCR/G Protein|||Neuroscience
Target: Dopamine Receptor|||5-HT Receptor|||Adrenergic Receptor|||Autophagy
Receptor: N/A
Bioactivity: Sertindole is an atypical antipsychotic that binds to dopamine D2 receptors and the serotonin (5-HT) receptor subtypes 5-HT1D, 5-HT2A, and 5-HT2C (Kds = 2.7, 20, 0.14, and 6 nM, respectively)
Molecular Weight: 440, 95