Product Overview
Sesamolin | T5S2283 | TargetMol Chemicals
CAS: 526-07-8
Smiles: C1Oc2ccc(O[C@H]3OC[C@H]4[C@@H]3CO[C@@H]4c3ccc4OCOc4c3)cc2O1
Formula: C20H18O7
Pathway: Apoptosis|||MAPK|||Proteases/Proteasome
Target: p38 MAPK|||Caspase|||JNK
Receptor: N/A
Bioactivity: 1. Sesamolin and Sesamin has neuroprotective effect. 2. Sesamolin protects microglia against H2O2-induced cell injury, by inhibiting of p38 MAPK and caspase-3 activation and ROS production. 3. Sesamolin and Sesamin can significantly attenuate the excess generation of nitric oxide in lipopolysaccharide-stimulated rat primary microglia cells.
Molecular Weight: 370, 357
