Product Overview
SF1126 | T16875 | TargetMol Chemicals
CAS: 936487-67-1
Smiles: NC(=N)NCCC[C@H](NC(=O)CCC(=O)OC[N+]1(CCOCC1)c1cc(=O)c2cccc(-c3ccccc3)c2o1)C(=O)NCC(=O)N[C@@H](CC([O-])=O)C(=O)N[C@@H](CO)C(O)=O
Formula: C39H48N8O14
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: SF1126 is a relevant pan and dual first-in-class PI3K/BRD4 inhibitor. SF1126 is an RGDS-conjugated LY294002 prodrug, which is designed to exhibit increased solubility and bind to specific integrins within the tumor compartment.
Molecular Weight: 852, 855