Shogaol | T6S1699

Shogaol | T6S1699 | TargetMol Chemicals

CAS: 555-66-8

Smiles: CCCCC\C=C\C(=O)CCc1ccc(O)c(OC)c1

Formula: C17H24O3

Pathway: Autophagy|||Metabolism

Target: Lipoxygenase|||Autophagy

Receptor: N/A

Bioactivity: 1. 6-Shogaol has antipyretic and analgesic effects in addition to inhibitory effect on lipoxygenase activity. 2. 6-shogaol has anti-inflammatory property, reduces the inflammatory response and protected the femoral cartilage from damage produced in a CFA monoarthritic model of the knee joint of rats. 3. 6-Shogaol inhibits the growth of human cancer cells and induces apoptosis in COLO 25 cells through modulation of mitochondrial functions regulated by reactive oxygen species (ROS). 4. 6-Shogaol effectively inhibit invasion and metastasis of hepatocellular carcinoma through diverse molecular mechanisms, including inhibition of the MAPK and PI3k/Akt pathways and NF-κB and STAT3 activities to suppress expression of MMP-2/-9 and uPA and block angiogenesis, could further regulate urokinase-type plasminogen activity.

Molecular Weight: 276, 37