Product Overview
Sinapine | T2S1200 | TargetMol Chemicals
CAS: 18696-26-9
Smiles: COc1cc(\C=C\C(=O)OCC[N+](C)(C)C)cc(OC)c1O
Formula: C16H24NO5
Pathway: Membrane transporter/Ion channel|||Neuroscience|||oxidation-reduction
Target: Antioxidant|||P-gp|||AChE
Receptor: N/A
Bioactivity: 1. Sinapine, an alkaloid from seeds of the cruciferous species, can be used as an effective natural compound for chemo-resistance. 2. Sinapine has antioxidant and radio-protective activities.
Molecular Weight: 310, 369
