Product Overview
Sipeimine | T6S0109 | TargetMol Chemicals
CAS: 61825-98-7
Smiles: C[C@H]1CC[C@@H]2N(C1)C[C@H]1[C@@H]3C[C@H]4[C@@H](CC(=O)[C@H]5C[C@@H](O)CC[C@]45C)[C@@H]3CC[C@H]1[C@]2(C)O
Formula: C27H43NO3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Sipeimine has antiasthmatic effect, on tracheal M receptor antagonist. 2. Sipeimine can make Kaba cholinergic induced contraction of tracheal strips of the dose-response curve to the right.
Molecular Weight: 429, 645
