Product Overview
SM21 perchlorate | T28815 | TargetMol Chemicals
CAS: 1352296-65-1
Smiles: [O-][Cl](=O)(=O)=O.CN(C)c1ccc(\C=C\c2cc([o+]c(c2)C(C)(C)C)C(C)(C)C)cc1
Formula: C23H32ClNO5
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: SM21 is a highly potent antifungal agent (MIC = 0.2-1.6 µg/ml) with no toxic to various human cell lines or bacterial species in vitro and was active against Candida isolates that are resistant to existing antifungal agents.
Molecular Weight: 437, 96
