Product Overview
SP-Chymostatin B | T26202 | TargetMol Chemicals
CAS: 70857-49-7
Smiles: CC(C)[C@H](N([C@@H](Cc1ccccc1)C=O)C(=O)[C@H](CCCNC(N)=N)NC(=O)NC(Cc1ccccc1)C(O)=O)C(N)=O
Formula: C30H41N7O6
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: SP-Chymostatin B is a potent inhibitor of many proteases, including chymotrypsin, papain, chymotrypsin-like serine proteinases, chymases, and lysosomal cysteine proteinases. It weakly inhibits human leucocyte elastase. It is effective at a final concentration of 100 to 200 μg/ml (10 to 100 μM).
Molecular Weight: 595, 701
