Product Overview
Spinosin | T6S2227 | TargetMol Chemicals
CAS: 72063-39-9
Smiles: [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c2c(OC)cc3oc(cc(=O)c3c2O)-c2ccc(O)cc2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Formula: C28H32O15
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Spinosin ameliorated memory impairment induced through AβO, the serotonergic neurotransmitter system, and these effects were regulated, in part, through neuroprotective activity via the anti-inflammatory effects of Spinosin. 2. Spinosin exerts anxiolytic-like effects, and its mechanism of action appears to be modulated by GABAA and 5-HT1A receptors. 3. There was a wide brain regional tissue distribution of Spinosin. The concentrations of Spinosin in corpus striatum and hippocampus were higher than that in other areas.
Molecular Weight: 608, 549
