Product Overview
Steviol | T2S1837 | TargetMol Chemicals
CAS: 471-80-7
Smiles: C[C@@]12CCC[C@](C)([C@H]1CC[C@@]13CC(=C)[C@@](O)(C1)CC[C@@H]23)C(O)=O
Formula: C20H30O3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Steviol, a natural sweetener, it inhibits proliferation of the gastrointestinal cancer cells intensively. 2. Steviol can induce a significant increase in CYP3A29 expression. 3. Steviol inhibits the proliferation of the human osteosarcoma U2OS cell line in a dose- and time-dependent manner. 4. Steviol can treat polycystic kidney disease, it slowed cyst growth, in part, by reducing AQP2 transcription, promoted proteasome, and lysosome-mediated AQP2 degradation.
Molecular Weight: 318, 457
