Substance P (1-7) 2TFA(68060-49-1(free base)) | T7675

Substance P (1-7) 2TFA(68060-49-1(free base)) | T7675 | TargetMol Chemicals

CAS: T7675

Smiles: N=C(N)NCCCC(N)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(CCC(N)=O)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F

Formula: C45H67F6N13O14

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: Substance P (1-7) 2TFA(68060-49-1(free base)) is the major bioactive metabolite formed after proteolytic degradation of the tachykinin substance P (SP), with anti-inflammatory, anti-nociceptive and anti-hyperalgesic effects

Molecular Weight: 1128, 08