Product Overview
Swertianolin | T5S2254 | TargetMol Chemicals
CAS: 23445-00-3
Smiles: COc1cc(O)c2c(c1)oc1c(O)ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c1c2=O
Formula: C20H20O11
Pathway: Microbiology/Virology|||Neuroscience|||Others
Target: Others|||HBV|||Antibacterial|||AChE
Receptor: N/A
Bioactivity: 1. Swertianolin, mangiferin, rhodenthoside A-C, isoorientin, isovitexin, and amarogentin would serve as potential chemotaxonomic markers to differentiate Gentianaceae species. 2. Swertianolin and swertiamarin show significant hepatoprotective effect in the liver damage model induced by alpha-naphthylisot hiocyanate. 3. Swertianolin shows anti-acetylcholinesterase activity effects. 4. Swertianolin shows that it can scavenge superoxide and hydroxyl radicals with the studying method of the autoxidation of Pyrogallol and afenton.
Molecular Weight: 436, 369