Product Overview
t-Boc-N-amido-PEG8-acid | T26251 | TargetMol Chemicals
CAS: 1334169-93-5
Smiles: O=C(OC(C)(C)C)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O
Formula: C24H47NO12
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: t-Boc-N-amido-PEG8-acid is a PEG derivative containing a terminal carboxylic acid and Boc-protected amino group. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or DCC) to form a stable amide bond.
Molecular Weight: 541, 63
