Product Overview
Talatisamine | T3S1873 | TargetMol Chemicals
CAS: 20501-56-8
Smiles: CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34[C@@H]5C[C@H]6[C@H](O)[C@@H]5[C@](O)(C[C@@H]6OC)[C@@H](C[C@H]23)C14
Formula: C24H39NO5
Pathway: Membrane transporter/Ion channel
Target: Potassium Channel
Receptor: N/A
Bioactivity: 1. Talatisamine (12 μM) and TEA (5mM) inhibits the enhanced I(K) caused by Aβ4 oligomers, attenuates cytotoxicity of Aβ oligomers by restoring cell viability and suppressing K(+) loss related apoptotic response. 2. Talatisamine can therefore be considered as a leading compound worthy of further investigations.
Molecular Weight: 421, 578