Product Overview
Tanaproget | T16985 | TargetMol Chemicals
CAS: 304853-42-7
Smiles: Cn1c(ccc1-c1ccc2NC(=S)OC(C)(C)c2c1)C#N
Formula: C16H15N3OS
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Tanaproget is a novel nonsteroidal progesterone receptor agonist which can bind to the PR from various species with a higher relative affinity than reference steroidal progestins (IC50: 0.1 nM),
Molecular Weight: 297, 38
