Product Overview
Tanshindiol B | TN5096 | TargetMol Chemicals
CAS: 97465-70-8
Smiles: Cc1coc-2c1C(=O)C(=O)c1c-2ccc2c1CC[C@H](O)[C@]2(C)O
Formula: C18H16O5
Pathway: Chromatin/Epigenetic
Target: Histone Methyltransferase
Receptor: N/A
Bioactivity: Tanshindiol B possesses a unique anti-cancer activity whose mechanism involves the inhibition of EZH2 activity and would provide chemically valuable information for designing a new class of potent EZH2 inhibitors. It also possesses the anti-angiogenic activity, so it can be a promising candidate for angiogenesis inhibitors.
Molecular Weight: 312, 3
