Product Overview
Taxinine B | TN5113 | TargetMol Chemicals
CAS: 18457-44-8
Smiles: CC(=O)O[C@H]1C[C@H](OC(=O)\C=C\c2ccccc2)C(=C)[C@H]2[C@H](OC(C)=O)[C@@H]3CC(=O)C(C)=C([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]12C)C3(C)C
Formula: C37H44O11
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Taxinine and taxinine B can inhibit the drug transport by P-glycoprotein in multidrug-resistant cells. Taxinine B shows stronger inhibitory effects than acetylsalicylic acid (ASA) on platelet aggregation induced by arachidonic acid (AA).
Molecular Weight: 664, 8
