Product Overview
Tectochrysin | T3S1775 | TargetMol Chemicals
CAS: 520-28-5
Smiles: COc1cc(O)c2c(c1)oc(cc2=O)-c1ccccc1
Formula: C16H12O4
Pathway: JAK/STAT signaling|||NF-Κb|||Stem Cells
Target: NF-κB|||STAT
Receptor: N/A
Bioactivity: 1. Tectochrysin has antioxidant effect. 2. Tectochrysin is promising inhibitors for the reversal of ABCG2-mediated drug transport. 3. Tectochrysin leads to apoptotic cell death in NSCLC cells through activation of DR3 and Fas expression via inhibition of STAT3 phosphorylation.
Molecular Weight: 268, 268