Product Overview
Telocinobufagin | T4A2462 | TargetMol Chemicals
CAS: 472-26-4
Smiles: C[C@]12CC[C@H]3[C@@H](CC[C@]4(O)C[C@@H](O)CC[C@]34C)[C@@]1(O)CC[C@@H]2c1ccc(=O)oc1
Formula: C24H34O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Telocinobufagin is the major endogenous digitalis-like factor. 2. Telocinobufagin significantly decreases the bacterial burdens in the spleen and prolongs the survival time of FIST-immunized mice challenged with live S. typhimurium. 3. Telocinobufagin has immunomodulatory activity, can enhance a Th1 immune response to control intracellular infections, could be developed as a novel immunotherapeutic agent to treat cancer and other immune-mediated diseases.
Molecular Weight: 402, 531