Product Overview
TG4-155 | T5482 | TargetMol Chemicals
CAS: 1164462-05-8
Smiles: COc1cc(\C=C\C(=O)NCCn2c(C)cc3ccccc23)cc(OC)c1OC
Formula: C23H26N2O4
Pathway: GPCR/G Protein|||Immunology/Inflammation
Target: Prostaglandin Receptor
Receptor: N/A
Bioactivity: TG4-155 is a brain penetrant EP2 antagonist (KB = 2.4 nM) that is over 1000-fold less effective at EP4 (KB = 11.4 μM) and a panel of other receptors and channels
Molecular Weight: 394, 471
