Product Overview
Theaflavin-3'-Gallate | T4S0553 | TargetMol Chemicals
CAS: 28543-07-9
Smiles: O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(=O)c2c(O)c(O)cc([C@H]3Oc4cc(O)cc(O)c4C[C@H]3OC(=O)c3cc(O)c(O)c(O)c3)c2c1
Formula: C36H28O16
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Theaflavin-3'-gallate usually comes from the leaves of Camellia sinensis (L.) O. Kuntze. Theaflavin-3'-gallate, act as prooxidants and induce oxidative stress, with carcinoma cells more sensitive than normal fibroblasts.
Molecular Weight: 716, 604
