Product Overview
Thermopsoside | T3S0964 | TargetMol Chemicals
CAS: 19993-32-9
Smiles: COc1cc(ccc1O)-c1cc(=O)c2c(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2o1
Formula: C22H22O11
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Chrysoeriol-7-O-glucoside can strongly inhibit the classical pathway of the complement system.Chrysoeriol-7-O-d-glucoside and luteolin-7-O-d-glucoside can inhibit palmitic acid uptake into small intestinal brush border membrane, apigenin-7-O-d-glucoside can inhibit alpha-amylase activity; they can enhance norepinephrine-induced lipolysis in fat cells.
Molecular Weight: 462, 4