Product Overview
Tioconazole | T0146 | TargetMol Chemicals
CAS: 65899-73-2
Smiles: Clc1sccc1COC(Cn1ccnc1)c1ccc(Cl)cc1Cl
Formula: C16H13Cl3N2OS
Pathway: Microbiology/Virology
Target: Antibiotic|||Antifection|||Antifungal
Receptor: N/A
Bioactivity: Tioconazole is a synthetic imidazole derivative, inhibits cell wall synthesis by inhibiting the biosynthesis of ergosterol or other sterols, damaging the fungal cell membrane, altering its permeability, and promoting loss of essential intracellular elements.
Molecular Weight: 387, 7
