Product Overview
Toosendanin | T6S0234 | TargetMol Chemicals
CAS: 58812-37-6
Smiles: CC(=O)O[C@@H]1C[C@H](O)[C@@]23COC(O)[C@]1(C)[C@@H]2C[C@@H](O)[C@]1(C)[C@@H]3C(=O)[C@H](OC(C)=O)[C@@]2(C)[C@@H](C[C@H]3O[C@@]123)c1ccoc1
Formula: C30H38O11
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Toosendanin possesses hepatotoxicity. 2. Toosendanin has effects on the growth, cell cycle arrest, induction of apoptosis and the involved signaling pathway in human promyelocytic leukemia HL-6 cells. 3. Toosendanin is an effective insecticide for Ae.
Molecular Weight: 574, 623
