Product Overview
Tos-PEG3 | T17129 | TargetMol Chemicals
CAS: 77544-68-4
Smiles: Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCO
Formula: C13H20O6S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Tos-PEG3 is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Tos-PEG3 (structure 1) can be used for the synthesis of 3'-aminooxy oligonucleotides solid supports[1].
Molecular Weight: 304, 36
