Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine | T17165

Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine | T17165 | TargetMol Chemicals

CAS: 175724-30-8

Smiles: CC(C)(C)OC(=O)CCOCC(N)(COCCC(=O)OC(C)(C)C)COCCC(=O)OC(C)(C)C

Formula: C25H47NO9

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine is a cleavable PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Amino-Tri-(t-butoxycarbonylethoxymethyl)-methane is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].

Molecular Weight: 505, 649