Product Overview
Tsugaric acid A | TN2286 | TargetMol Chemicals
CAS: 174391-64-1
Smiles: [H][C@@]12CCC3=C(CC[C@]4(C)[C@H](CC[C@@]34C)[C@@H](CCC=C(C)C)C(O)=O)[C@@]1(C)CC[C@@H](OC(C)=O)C2(C)C
Formula: C32H50O4
Pathway: Immunology/Inflammation
Target: NO Synthase
Receptor: N/A
Bioactivity: Tsugaric acid A can significantly inhibit superoxide anion formation in fMLP/CB-stimulated rat neutrophils, it is also able to protect human keratinocytes against damage induced by ultraviolet B (UV B) light, indicates that tsugaric acid A can protect keratinocytes from photodamage.
Molecular Weight: 498, 748
