Product Overview
Tubulysin M | T13944 | TargetMol Chemicals
CAS: 936691-46-2
Smiles: CC[C@H](C)[C@H](NC(=O)[C@H]1CCCCN1C)C(=O)N(C)[C@H](C[C@@H](OC(C)=O)c1nc(cs1)C(=O)N[C@H](C[C@H](C)C(O)=O)Cc1ccccc1)C(C)C
Formula: C38H57N5O7S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Tubulysin M is a natural product isolated from the myxobacterial species Archangium geophyra and Angiococcus disciformis, and is a highly cytotoxic peptide. Tubulysin M is a cytotoxic activity tubulysin that inhibits tubulin polymerization and leads to cell cycle arrest and apoptosis.
Molecular Weight: 727, 96
