Product Overview
Tussilagone | T6S1027 | TargetMol Chemicals
CAS: 104012-37-5
Smiles: CC\C(C)=C\C(=O)O[C@@H]1C[C@@H](C(C)C)[C@H]2[C@@H](CC(=O)[C@@H]2[C@@H](C)OC(C)=O)C1=C
Formula: C23H34O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Tussilagone inhibits dendritic cell function through the induction of heme oxygenase-1. 2. Tussilagone has anti-cancer activity, might be a potential chemotherapeutic agent for the prevention and treatment of human colon cancer. 3. Tussilagone has anti-oxidant and anti-inflammatory activities, may be an effective oxygenase-1 inducer and a valuable compound for modulating inflammatory conditions. 4. Tussilagone has potential treatment of neuro-inflammatory diseases through the inhibition of overproduction of nitric oxide and prostaglandin E(2) .
Molecular Weight: 390, 52