Product Overview
Tyrosylleucine | T20443 | TargetMol Chemicals
CAS: 17355-10-1
Smiles: CC(C)C[C@@H](C(O)=O)NC([C@H](CC1=CC=C(O)C=C1)N)=O
Formula: C15H22N2O4
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Tyrosylleucine is a dipeptide composed of tyrosine and leucine. Some dipeptides are known to have physiological or cell-signaling effects although most are simply short-lived intermediates on their way to specific amino acid degradation pathways following further proteolysis.
Molecular Weight: 294, 35