Product Overview
UNC1215 | T2379 | TargetMol Chemicals
CAS: 1415800-43-9
Smiles: O=C(N1CCC(CC1)N1CCCC1)c1ccc(C(=O)N2CCC(CC2)N2CCCC2)c(Nc2ccccc2)c1
Formula: C32H43N5O2
Pathway: Apoptosis|||Chromatin/Epigenetic
Target: Apoptosis|||Epigenetic Reader Domain|||Histone Methyltransferase
Receptor: N/A
Bioactivity: UNC1215, an effective and specific MBT (malignant brain tumor) antagonist, binds L3MBTL3 (IC50/Kd: 40/120 nM). The selectivity of UNC1215 for L3MBTL3 is 50-fold higher versus other members of the human MBT family.
Molecular Weight: 529, 729
