Product Overview
Vatiquinone | T35040 | TargetMol Chemicals
CAS: 1213269-98-7
Smiles: CC(C)=CCC\C(C)=C\CC\C(C)=C\CC[C@@](C)(O)CCC1=C(C)C(=O)C(C)=C(C)C1=O
Formula: C29H44O3
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Vatiquinone, also known as EPI 743, is an orally bioavailable para-benzoquinone being developed for inherited mitochondrial diseases. The mechanism of action of EPI-743 involves augmenting the synthesis of glutathione, optimizing metabolic control, enhancing the expression of genetic elements critical for cellular management of oxidative stress, and acting at the mitochondria to regulate electron transport.
Molecular Weight: 440, 668