Product Overview
Vibralactone B | TN5229 | TargetMol Chemicals
CAS: 1093230-95-5
Smiles: CC(C)=CC[C@@]12[C@H]3O[C@@]3(CO)C[C@@H]1OC2=O
Formula: C12H16O4
Pathway: Microbiology/Virology
Target: Antifection
Receptor: N/A
Bioactivity: Vibralactone B shows antibacterial activity, it can inhibit significantly the growth of E. coli and Pseudomonas aeruginosa, with MBC values of 50 and 100 ug/mL, respectively.
Molecular Weight: 224, 26
