Product Overview
Vindesine sulfate | T22455 | TargetMol Chemicals
CAS: 59917-39-4
Smiles: OS(O)(=O)=O.CC[C@]1(O)C[C@H]2CN(C1)CCc1c([nH]c3ccccc13)[C@@](C2)(C(=O)OC)c1cc2c(cc1OC)N(C)[C@@H]1[C@]22CCN3CC=C[C@](CC)([C@@H]23)[C@@H](O)[C@]1(O)C(N)=O
Formula: C43H57N5O11S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Vindesine sulfate is a vinca alkaloid which is a synthetic derivative of vinblastine, binds to the microtubular proteins of the mitotic spindle, leading to crystallization of the microtubule and mitotic arrest or cell death.
Molecular Weight: 852, 01
