Product Overview
Vinorelbine | T0190 | TargetMol Chemicals
CAS: 71486-22-1
Smiles: CCC1=C[C@@H]2CN(C1)Cc1c([nH]c3ccccc13)[C@@](C2)(C(=O)OC)c1cc2c(cc1OC)N(C)[C@@H]1[C@]22CCN3CC=C[C@](CC)([C@@H]23)[C@@H](OC(C)=O)[C@]1(O)C(=O)OC
Formula: C45H54N4O8
Pathway: Cytoskeletal Signaling
Target: Microtubule Associated
Receptor: N/A
Bioactivity: Vinorelbine is a semisynthetic vinca alkaloid. Vinorelbine binds to tubulin and prevents the formation of the mitotic spindle, resulting in the arrest of tumor cell growth in metaphase.
Molecular Weight: 778, 947
