Product Overview
Vitexin | T6S1369 | TargetMol Chemicals
CAS: 3681-93-4
Smiles: OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)c1c(O)cc(O)c2c1oc(cc2=O)-c1ccc(O)cc1
Formula: C21H20O10
Pathway: oxidation-reduction
Target: Antioxidant
Receptor: N/A
Bioactivity: 1. Vitexin has antinociceptive and antispasmodic activities. 2. Vitexin exhibits a prominent first-pass effect. 3. Vitexin has antioxidant, antimyeloperoxidase, and α-glucosidase inhibitory activities. 4. Vitexin can either inhibit or induce activities of CYP2C11 and CYP3A1. 5. Vitexin induces the novel p53-dependent metastatic and apoptotic pathway. 6. Vitexin protects brain against cerebral I/R injury, and this effect may be regulated by mitogen-activated protein kinase (MAPK) and apoptosis signaling pathways.
Molecular Weight: 432, 381