Product Overview
Voacangine | TN5246 | TargetMol Chemicals
CAS: 510-22-5
Smiles: CC[C@H]1C[C@H]2CN3CCc4c([nH]c5ccc(OC)cc45)[C@](C2)([C@H]13)C(=O)OC
Formula: C22H28N2O3
Pathway: Angiogenesis|||Tyrosine Kinase/Adaptors
Target: VEGFR
Receptor: N/A
Bioactivity: Voacangine is a novel transient receptor potential vanilloid type 1 (TRPV1) antagonist, it shows mod. cytotoxic activity, also some CNS, brachycardial and hypotensive action.Voacangine significantly suppresses in vitro angiogenesis, such as VEGF-induced tube formation and chemoinvasion.
Molecular Weight: 368, 5