Product Overview
X1 compound | T60044 | TargetMol Chemicals
CAS: T60044
Smiles: C1=CC=C(COC2=CC(C3=CC=C4NN=C(C5=NC6=C(C=CC=C6)N5)C4=C3)=CC=C2)C=C1
Formula: C27H20N4O
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: X1 compound binding suppresses histone H3K27 trimethylation and blocks initiation of X-chromosome inactivation. X1 compound binding reduces the conformational space of RepA and displaces cognate interacting protein factors including PRC2 and SPEN.
Molecular Weight: 416, 48
